C46H90N2O5S — CID 173310826
4-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2,3-bis(octadec-9-enoxy)butanethioamide (PubChem CID 173310826) has the molecular formula C46H90N2O5S and a molecular weight of 783.30 g/mol. Its IUPAC name is 4-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2,3-bis(octadec-9-enoxy)butanethioamide.
| Compound Name | 4-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2,3-bis(octadec-9-enoxy)butanethioamide |
|---|---|
| PubChem CID | 173310826 |
| Molecular Formula | C46H90N2O5S |
| Molecular Weight | 783.30 g/mol |
| Exact Mass | 782.66 |
| IUPAC Name | 4-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2,3-bis(octadec-9-enoxy)butanethioamide |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(COCCN(CCO)CCO)C(OCCCCCCCCC=CCCCCCCCC)C(N)=S |
| InChI | InChI=1S/C46H90N2O5S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40-52-44(43-51-42-37-48(35-38-49)36-39-50)45(46(47)54)53-41-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,44-45,49-50H,3-16,21-43H2,1-2H3,(H2,47,54) |
| InChIKey | KVONAMMGLQKZLR-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.30 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|