C32H25N3O7S2 — CID 159018419
N-(diaminomethylidene)-1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxamide;methyl 1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxylate (PubChem CID 159018419) has the molecular formula C32H25N3O7S2 and a molecular weight of 627.70 g/mol. Its IUPAC name is N-(diaminomethylidene)-1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxamide;methyl 1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxylate.
| Compound Name | N-(diaminomethylidene)-1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxamide;methyl 1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxylate |
|---|---|
| PubChem CID | 159018419 |
| Molecular Formula | C32H25N3O7S2 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | N-(diaminomethylidene)-1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxamide;methyl 1,1-dioxo-3-phenyl-1-benzothiophene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)S(=O)(=O)C=C2c1ccccc1.NC(N)=NC(=O)c1ccc2c(c1)S(=O)(=O)C=C2c1ccccc1 |
| InChI | InChI=1S/C16H13N3O3S.C16H12O4S/c17-16(18)19-15(20)11-6-7-12-13(10-4-2-1-3-5-10)9-23(21,22)14(12)8-11;1-20-16(17)12-7-8-13-14(11-5-3-2-4-6-11)10-21(18,19)15(13)9-12/h1-9H,(H4,17,18,19,20);2-10H,1H3 |
| InChIKey | JTJNWNWEXSPNGB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 176.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|