C22H25N3O9S2 — CID 158409721
N-(diaminomethylidene)-3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxamide;methyl 3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxylate (PubChem CID 158409721) has the molecular formula C22H25N3O9S2 and a molecular weight of 539.59 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxamide;methyl 3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxylate.
| Compound Name | N-(diaminomethylidene)-3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxamide;methyl 3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxylate |
|---|---|
| PubChem CID | 158409721 |
| Molecular Formula | C22H25N3O9S2 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-(diaminomethylidene)-3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxamide;methyl 3-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)S(=O)(=O)CC(O)C2.NC(N)=NC(=O)c1ccc2c(c1)S(=O)(=O)CC(O)C2 |
| InChI | InChI=1S/C11H13N3O4S.C11H12O5S/c12-11(13)14-10(16)7-2-1-6-3-8(15)5-19(17,18)9(6)4-7;1-16-11(13)8-3-2-7-4-9(12)6-17(14,15)10(7)5-8/h1-2,4,8,15H,3,5H2,(H4,12,13,14,16);2-3,5,9,12H,4,6H2,1H3 |
| InChIKey | GZDNTZSKEBISOG-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 216.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|