C22H31ClN10O — CID 159023474
4-N-(4-chlorophenyl)-6-methyl-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine;2-[2-(furan-3-yl)ethylimino]-7-methyl-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine (PubChem CID 159023474) has the molecular formula C22H31ClN10O and a molecular weight of 487.01 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-6-methyl-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine;2-[2-(furan-3-yl)ethylimino]-7-methyl-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine.
| Compound Name | 4-N-(4-chlorophenyl)-6-methyl-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine;2-[2-(furan-3-yl)ethylimino]-7-methyl-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine |
|---|---|
| PubChem CID | 159023474 |
| Molecular Formula | C22H31ClN10O |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 4-N-(4-chlorophenyl)-6-methyl-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine;2-[2-(furan-3-yl)ethylimino]-7-methyl-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine |
| SMILES | CC1CN=C(N)N/C(=N/CCc2ccoc2)N1.CC1CN=C(N)NC(Nc2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C11H14ClN5.C11H17N5O/c1-7-6-14-10(13)17-11(15-7)16-9-4-2-8(12)3-5-9;1-8-6-14-10(12)16-11(15-8)13-4-2-9-3-5-17-7-9/h2-5,7H,6H2,1H3,(H4,13,14,15,16,17);3,5,7-8H,2,4,6H2,1H3,(H4,12,13,14,15,16) |
| InChIKey | JTZNAICNFFGFAP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 162.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|