C21H20Cl2N4 — CID 21417097
N-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-5-methyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 21417097) has the molecular formula C21H20Cl2N4 and a molecular weight of 399.33 g/mol. Its IUPAC name is N-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-5-methyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-5-methyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 21417097 |
| Molecular Formula | C21H20Cl2N4 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-5-methyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC1CN=C(NN=C(/C=C/c2ccc(Cl)cc2)/C=C/c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C21H20Cl2N4/c1-15-14-24-21(25-15)27-26-20(12-6-16-2-8-18(22)9-3-16)13-7-17-4-10-19(23)11-5-17/h2-13,15H,14H2,1H3,(H2,24,25,27)/b12-6+,13-7+ |
| InChIKey | JUQYTUVPBNQKGF-PWHKKFIBSA-N |
| XLogP | 5.01 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|