C24H29Cl2IN4 — CID 21417067
1-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-2,3-di(propan-2-yl)guanidine;hydroiodide (PubChem CID 21417067) has the molecular formula C24H29Cl2IN4 and a molecular weight of 571.33 g/mol. Its IUPAC name is 1-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-2,3-di(propan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-2,3-di(propan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 21417067 |
| Molecular Formula | C24H29Cl2IN4 |
| Molecular Weight | 571.33 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 1-[[(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylidene]amino]-2,3-di(propan-2-yl)guanidine;hydroiodide |
| SMILES | CC(C)/N=C(/NN=C(/C=C/c1ccc(Cl)cc1)/C=C/c1ccc(Cl)cc1)NC(C)C.I |
| InChI | InChI=1S/C24H28Cl2N4.HI/c1-17(2)27-24(28-18(3)4)30-29-23(15-9-19-5-11-21(25)12-6-19)16-10-20-7-13-22(26)14-8-20;/h5-18H,1-4H3,(H2,27,28,30);1H/b15-9+,16-10+; |
| InChIKey | OPUSRFFNXDQGNS-XETSTSIRSA-N |
| XLogP | 7.05 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.33 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|