C19H18Cl2N4 — CID 131710865
1-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-2-methylguanidine (PubChem CID 131710865) has the molecular formula C19H18Cl2N4 and a molecular weight of 373.29 g/mol. Its IUPAC name is 1-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-2-methylguanidine.
| Compound Name | 1-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-2-methylguanidine |
|---|---|
| PubChem CID | 131710865 |
| Molecular Formula | C19H18Cl2N4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-2-methylguanidine |
| SMILES | C/N=C(\N)NN=C(C=Cc1ccc(Cl)cc1)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N4/c1-23-19(22)25-24-18(12-6-14-2-8-16(20)9-3-14)13-7-15-4-10-17(21)11-5-15/h2-13H,1H3,(H3,22,23,25) |
| InChIKey | NGHHMWMCEGCMGT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|