C8H11ClN6 — CID 69017102
2-(4-chlorophenyl)-1-(diaminomethylideneamino)guanidine (PubChem CID 69017102) has the molecular formula C8H11ClN6 and a molecular weight of 226.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(diaminomethylideneamino)guanidine.
| Compound Name | 2-(4-chlorophenyl)-1-(diaminomethylideneamino)guanidine |
|---|---|
| PubChem CID | 69017102 |
| Molecular Formula | C8H11ClN6 |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(diaminomethylideneamino)guanidine |
| SMILES | NC(N)=NN/C(N)=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H11ClN6/c9-5-1-3-6(4-2-5)13-8(12)15-14-7(10)11/h1-4H,(H4,10,11,14)(H3,12,13,15) |
| InChIKey | FMNAOFVOTZWGKS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|