C11H13ClN4O2S — CID 135470072
N-[[N'-(4-chlorophenyl)carbamimidoyl]carbamoyl]-2-methylsulfanylacetamide (PubChem CID 135470072) has the molecular formula C11H13ClN4O2S and a molecular weight of 300.77 g/mol. Its IUPAC name is N-[[N'-(4-chlorophenyl)carbamimidoyl]carbamoyl]-2-methylsulfanylacetamide.
| Compound Name | N-[[N'-(4-chlorophenyl)carbamimidoyl]carbamoyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 135470072 |
| Molecular Formula | C11H13ClN4O2S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-[[N'-(4-chlorophenyl)carbamimidoyl]carbamoyl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)NC(=O)N/C(N)=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN4O2S/c1-19-6-9(17)15-11(18)16-10(13)14-8-4-2-7(12)3-5-8/h2-5H,6H2,1H3,(H4,13,14,15,16,17,18) |
| InChIKey | BZIPOHFHODRGOQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|