About 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane
3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane (PubChem CID 142010859) has the molecular formula C19H24ClN3O2
and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane.
Molecular Properties
| Compound Name | 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane |
| PubChem CID | 142010859 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane |
| SMILES | CCC.COc1ccc(/N=C(\N)NC(=O)c2cc(C)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16ClN3O2.C3H8/c1-10-7-11(9-12(17)8-10)15(21)20-16(18)19-13-3-5-14(22-2)6-4-13;1-3-2/h3-9H,1-2H3,(H3,18,19,20,21);3H2,1-2H3 |
| InChIKey | YACXIOFLLQSVEY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane?
The IUPAC name of 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane (CID 142010859) is 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane.
What is the SMILES notation for 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane?
The canonical SMILES for 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane is CCC.COc1ccc(/N=C(\N)NC(=O)c2cc(C)cc(Cl)c2)cc1.
What is the InChIKey of 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane?
The InChIKey is YACXIOFLLQSVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O2.C3H8/c1-10-7-11(9-12(17)8-10)15(21)20-16(18)19-13-3-5-14(22-2)6-4-13;1-3-2/h3-9H,1-2H3,(H3,18,19,20,21);3H2,1-2H3.
What are the key properties of 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane?
3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane has a molecular weight of 361.87 g/mol, XLogP of 4.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[N'-(4-methoxyphenyl)carbamimidoyl]-5-methylbenzamide;propane is sourced from PubChem (CID 142010859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).