C15H20ClN3S — CID 5385465
1-[(Z)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]-3-(2-methylpropyl)thiourea (PubChem CID 5385465) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is 1-[(Z)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(Z)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 5385465 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[(Z)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]-3-(2-methylpropyl)thiourea |
| SMILES | CC(/C=C/c1ccc(Cl)cc1)=N/NC(=S)NCC(C)C |
| InChI | InChI=1S/C15H20ClN3S/c1-11(2)10-17-15(20)19-18-12(3)4-5-13-6-8-14(16)9-7-13/h4-9,11H,10H2,1-3H3,(H2,17,19,20)/b5-4+,18-12- |
| InChIKey | JDLIFNREONCVFA-WEQJRMIKSA-N |
| XLogP | 3.85 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|