C12H14ClN3O2 — CID 46191883
2-[(E)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]oxyacetohydrazide (PubChem CID 46191883) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-[(E)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]oxyacetohydrazide.
| Compound Name | 2-[(E)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]oxyacetohydrazide |
|---|---|
| PubChem CID | 46191883 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-[(E)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]oxyacetohydrazide |
| SMILES | CC(/C=C/c1ccc(Cl)cc1)=N\OCC(=O)NN |
| InChI | InChI=1S/C12H14ClN3O2/c1-9(16-18-8-12(17)15-14)2-3-10-4-6-11(13)7-5-10/h2-7H,8,14H2,1H3,(H,15,17)/b3-2+,16-9+ |
| InChIKey | UQPWKDXZEBOTAO-PHDAYQIUSA-N |
| XLogP | 1.74 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|