C26H24Cl2N4O — CID 157385774
1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one;(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine (PubChem CID 157385774) has the molecular formula C26H24Cl2N4O and a molecular weight of 479.41 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one;(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine.
| Compound Name | 1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one;(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 157385774 |
| Molecular Formula | C26H24Cl2N4O |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one;(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)hydrazine |
| SMILES | NNC1=NCC(c2ccccc2)N1.O=C(C=Cc1ccc(Cl)cc1)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12Cl2O.C9H12N4/c18-15-7-1-13(2-8-15)5-11-17(20)12-6-14-3-9-16(19)10-4-14;10-13-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-12H;1-5,8H,6,10H2,(H2,11,12,13) |
| InChIKey | BLKHCEUGQUJXPG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|