C11H17N5O — CID 136590984
6-(furan-3-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136590984) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-(furan-3-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-(furan-3-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590984 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-(furan-3-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC1N=C(N(C)C)N/C(=N\Cc2ccoc2)N1 |
| InChI | InChI=1S/C11H17N5O/c1-8-13-10(15-11(14-8)16(2)3)12-6-9-4-5-17-7-9/h4-5,7-8H,6H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | QDAIWEPEJJOODZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 65.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|