C28H28N4O2S — CID 159024322
(5Z)-5-[[2-[4-[3-(5-phenyl-2-pyridinyl)propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 159024322) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[3-(5-phenyl-2-pyridinyl)propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[3-(5-phenyl-2-pyridinyl)propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 159024322 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (5Z)-5-[[2-[4-[3-(5-phenyl-2-pyridinyl)propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | O=C1CC(=O)/C(=C/c2ccnc(N3CCC(CCCc4ccc(-c5ccccc5)cn4)CC3)n2)S1 |
| InChI | InChI=1S/C28H28N4O2S/c33-25-18-27(34)35-26(25)17-24-11-14-29-28(31-24)32-15-12-20(13-16-32)5-4-8-23-10-9-22(19-30-23)21-6-2-1-3-7-21/h1-3,6-7,9-11,14,17,19-20H,4-5,8,12-13,15-16,18H2/b26-17- |
| InChIKey | MFZXLWBTGXRUSI-ONUIUJJFSA-N |
| XLogP | 5.35 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|