C24H25N5O2S — CID 58312775
(5Z)-5-[[2-[4-[(3H-indol-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 58312775) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[(3H-indol-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[(3H-indol-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 58312775 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (5Z)-5-[[2-[4-[(3H-indol-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | O=C1CC(=O)/C(=C/c2ccnc(N3CCC(CNCC4=Nc5ccccc5C4)CC3)n2)S1 |
| InChI | InChI=1S/C24H25N5O2S/c30-21-13-23(31)32-22(21)12-18-5-8-26-24(28-18)29-9-6-16(7-10-29)14-25-15-19-11-17-3-1-2-4-20(17)27-19/h1-5,8,12,16,25H,6-7,9-11,13-15H2/b22-12- |
| InChIKey | AXNKKORVDJCLDD-UUYOSTAYSA-N |
| XLogP | 3.18 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|