C25H26N6O2S — CID 161484551
(5Z)-5-[[2-[4-[3-[2-(1H-pyrazol-5-yl)-3-pyridinyl]propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 161484551) has the molecular formula C25H26N6O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[3-[2-(1H-pyrazol-5-yl)-3-pyridinyl]propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[3-[2-(1H-pyrazol-5-yl)-3-pyridinyl]propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 161484551 |
| Molecular Formula | C25H26N6O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (5Z)-5-[[2-[4-[3-[2-(1H-pyrazol-5-yl)-3-pyridinyl]propyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | O=C1CC(=O)/C(=C/c2ccnc(N3CCC(CCCc4cccnc4-c4ccn[nH]4)CC3)n2)S1 |
| InChI | InChI=1S/C25H26N6O2S/c32-21-16-23(33)34-22(21)15-19-6-11-27-25(29-19)31-13-8-17(9-14-31)3-1-4-18-5-2-10-26-24(18)20-7-12-28-30-20/h2,5-7,10-12,15,17H,1,3-4,8-9,13-14,16H2,(H,28,30)/b22-15- |
| InChIKey | NDDDRYNYYPTAFG-JCMHNJIXSA-N |
| XLogP | 4.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|