C23H25N9O2S — CID 154062176
5-[[2-[4-[[[6-amino-2-(1H-pyrazol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062176) has the molecular formula C23H25N9O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is 5-[[2-[4-[[[6-amino-2-(1H-pyrazol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[6-amino-2-(1H-pyrazol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062176 |
| Molecular Formula | C23H25N9O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 5-[[2-[4-[[[6-amino-2-(1H-pyrazol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Nc1ccc(CNCC2CCN(c3nccc(C=C4SC(=O)NC4=O)n3)CC2)c(-c2ccn[nH]2)n1 |
| InChI | InChI=1S/C23H25N9O2S/c24-19-2-1-15(20(29-19)17-4-8-27-31-17)13-25-12-14-5-9-32(10-6-14)22-26-7-3-16(28-22)11-18-21(33)30-23(34)35-18/h1-4,7-8,11,14,25H,5-6,9-10,12-13H2,(H2,24,29)(H,27,31)(H,30,33,34) |
| InChIKey | PXYDIIHQBKMDFX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|