C23H24N8O2S — CID 154062183
5-[[2-[4-[[[2-(1H-pyrazol-5-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062183) has the molecular formula C23H24N8O2S and a molecular weight of 476.57 g/mol. Its IUPAC name is 5-[[2-[4-[[[2-(1H-pyrazol-5-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[2-(1H-pyrazol-5-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062183 |
| Molecular Formula | C23H24N8O2S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 5-[[2-[4-[[[2-(1H-pyrazol-5-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4ccnc(-c5ccn[nH]5)c4)CC3)n2)S1 |
| InChI | InChI=1S/C23H24N8O2S/c32-21-20(34-23(33)29-21)12-17-2-7-26-22(28-17)31-9-4-15(5-10-31)13-24-14-16-1-6-25-19(11-16)18-3-8-27-30-18/h1-3,6-8,11-12,15,24H,4-5,9-10,13-14H2,(H,27,30)(H,29,32,33) |
| InChIKey | FOWGAGRKYTXWGW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|