C24H24FN7O2S — CID 154062290
5-[[2-[4-[[[5-fluoro-2-(1H-pyrrol-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062290) has the molecular formula C24H24FN7O2S and a molecular weight of 493.57 g/mol. Its IUPAC name is 5-[[2-[4-[[[5-fluoro-2-(1H-pyrrol-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[5-fluoro-2-(1H-pyrrol-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062290 |
| Molecular Formula | C24H24FN7O2S |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 5-[[2-[4-[[[5-fluoro-2-(1H-pyrrol-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4cc(-c5ccc[nH]5)ncc4F)CC3)n2)S1 |
| InChI | InChI=1S/C24H24FN7O2S/c25-18-14-29-20(19-2-1-6-27-19)10-16(18)13-26-12-15-4-8-32(9-5-15)23-28-7-3-17(30-23)11-21-22(33)31-24(34)35-21/h1-3,6-7,10-11,14-15,26-27H,4-5,8-9,12-13H2,(H,31,33,34) |
| InChIKey | JOVDXWTUVSYIIK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|