C21H39ClN4O5 — CID 159026211
1-(2-aminopropoxy)propan-2-amine;N-[1-[2-(prop-2-enoylamino)propoxy]propan-2-yl]prop-2-enamide;prop-2-enoyl chloride (PubChem CID 159026211) has the molecular formula C21H39ClN4O5 and a molecular weight of 463.02 g/mol. Its IUPAC name is 1-(2-aminopropoxy)propan-2-amine;N-[1-[2-(prop-2-enoylamino)propoxy]propan-2-yl]prop-2-enamide;prop-2-enoyl chloride.
| Compound Name | 1-(2-aminopropoxy)propan-2-amine;N-[1-[2-(prop-2-enoylamino)propoxy]propan-2-yl]prop-2-enamide;prop-2-enoyl chloride |
|---|---|
| PubChem CID | 159026211 |
| Molecular Formula | C21H39ClN4O5 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-(2-aminopropoxy)propan-2-amine;N-[1-[2-(prop-2-enoylamino)propoxy]propan-2-yl]prop-2-enamide;prop-2-enoyl chloride |
| SMILES | C=CC(=O)Cl.C=CC(=O)NC(C)COCC(C)NC(=O)C=C.CC(N)COCC(C)N |
| InChI | InChI=1S/C12H20N2O3.C6H16N2O.C3H3ClO/c1-5-11(15)13-9(3)7-17-8-10(4)14-12(16)6-2;1-5(7)3-9-4-6(2)8;1-2-3(4)5/h5-6,9-10H,1-2,7-8H2,3-4H3,(H,13,15)(H,14,16);5-6H,3-4,7-8H2,1-2H3;2H,1H2 |
| InChIKey | JUHSPEWVQYEAHZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|