C34H34F6O9S — CID 159029321
4-cyclopentyl-2-fluorobenzoic acid;methyl 4-cyclopentyl-2-fluorobenzoate;methyl 2-fluoro-4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 159029321) has the molecular formula C34H34F6O9S and a molecular weight of 732.69 g/mol. Its IUPAC name is 4-cyclopentyl-2-fluorobenzoic acid;methyl 4-cyclopentyl-2-fluorobenzoate;methyl 2-fluoro-4-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | 4-cyclopentyl-2-fluorobenzoic acid;methyl 4-cyclopentyl-2-fluorobenzoate;methyl 2-fluoro-4-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 159029321 |
| Molecular Formula | C34H34F6O9S |
| Molecular Weight | 732.69 g/mol |
| Exact Mass | 732.18 |
| IUPAC Name | 4-cyclopentyl-2-fluorobenzoic acid;methyl 4-cyclopentyl-2-fluorobenzoate;methyl 2-fluoro-4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1ccc(C2CCCC2)cc1F.COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1F.O=C(O)c1ccc(C2CCCC2)cc1F |
| InChI | InChI=1S/C13H15FO2.C12H13FO2.C9H6F4O5S/c1-16-13(15)11-7-6-10(8-12(11)14)9-4-2-3-5-9;13-11-7-9(8-3-1-2-4-8)5-6-10(11)12(14)15;1-17-8(14)6-3-2-5(4-7(6)10)18-19(15,16)9(11,12)13/h6-9H,2-5H2,1H3;5-8H,1-4H2,(H,14,15);2-4H,1H3 |
| InChIKey | JURGLNLMYKDDQQ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.69 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|