C33H38F6O5 — CID 22852152
1-(5-ethoxy-2,2,3,3,4,4-hexafluoropentoxy)-4-phenylbenzene;4-[(4S)-4-methylhexoxy]benzoic acid (PubChem CID 22852152) has the molecular formula C33H38F6O5 and a molecular weight of 628.65 g/mol. Its IUPAC name is 1-(5-ethoxy-2,2,3,3,4,4-hexafluoropentoxy)-4-phenylbenzene;4-[(4S)-4-methylhexoxy]benzoic acid.
| Compound Name | 1-(5-ethoxy-2,2,3,3,4,4-hexafluoropentoxy)-4-phenylbenzene;4-[(4S)-4-methylhexoxy]benzoic acid |
|---|---|
| PubChem CID | 22852152 |
| Molecular Formula | C33H38F6O5 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 1-(5-ethoxy-2,2,3,3,4,4-hexafluoropentoxy)-4-phenylbenzene;4-[(4S)-4-methylhexoxy]benzoic acid |
| SMILES | CCOCC(F)(F)C(F)(F)C(F)(F)COc1ccc(-c2ccccc2)cc1.CC[C@H](C)CCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H18F6O2.C14H20O3/c1-2-26-12-17(20,21)19(24,25)18(22,23)13-27-16-10-8-15(9-11-16)14-6-4-3-5-7-14;1-3-11(2)5-4-10-17-13-8-6-12(7-9-13)14(15)16/h3-11H,2,12-13H2,1H3;6-9,11H,3-5,10H2,1-2H3,(H,15,16)/t;11-/m.0/s1 |
| InChIKey | CZCICWMSANBHIR-WUSPCOQVSA-N |
| XLogP | 9.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|