C28H30O5 — CID 67724824
2-methylbutyl 4-phenylbenzoate;4-prop-2-enoxybenzoic acid (PubChem CID 67724824) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-methylbutyl 4-phenylbenzoate;4-prop-2-enoxybenzoic acid.
| Compound Name | 2-methylbutyl 4-phenylbenzoate;4-prop-2-enoxybenzoic acid |
|---|---|
| PubChem CID | 67724824 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-methylbutyl 4-phenylbenzoate;4-prop-2-enoxybenzoic acid |
| SMILES | C=CCOc1ccc(C(=O)O)cc1.CCC(C)COC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20O2.C10H10O3/c1-3-14(2)13-20-18(19)17-11-9-16(10-12-17)15-7-5-4-6-8-15;1-2-7-13-9-5-3-8(4-6-9)10(11)12/h4-12,14H,3,13H2,1-2H3;2-6H,1,7H2,(H,11,12) |
| InChIKey | WLPPJYLKDSEODU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|