C26H29F7O4 — CID 22852146
[4-[4-(5-butoxy-2,2,3,3,4,4-hexafluoropentoxy)phenyl]phenyl] (2S)-2-fluoropentanoate (PubChem CID 22852146) has the molecular formula C26H29F7O4 and a molecular weight of 538.50 g/mol. Its IUPAC name is [4-[4-(5-butoxy-2,2,3,3,4,4-hexafluoropentoxy)phenyl]phenyl] (2S)-2-fluoropentanoate.
| Compound Name | [4-[4-(5-butoxy-2,2,3,3,4,4-hexafluoropentoxy)phenyl]phenyl] (2S)-2-fluoropentanoate |
|---|---|
| PubChem CID | 22852146 |
| Molecular Formula | C26H29F7O4 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | [4-[4-(5-butoxy-2,2,3,3,4,4-hexafluoropentoxy)phenyl]phenyl] (2S)-2-fluoropentanoate |
| SMILES | CCCCOCC(F)(F)C(F)(F)C(F)(F)COc1ccc(-c2ccc(OC(=O)[C@@H](F)CCC)cc2)cc1 |
| InChI | InChI=1S/C26H29F7O4/c1-3-5-15-35-16-24(28,29)26(32,33)25(30,31)17-36-20-11-7-18(8-12-20)19-9-13-21(14-10-19)37-23(34)22(27)6-4-2/h7-14,22H,3-6,15-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | DWLQHQSPXMHLSL-QFIPXVFZSA-N |
| XLogP | 7.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|