C28H30F3NO4 — CID 22913170
[4-[6-(4-butoxyphenyl)-3-pyridinyl]phenyl] 2-butoxy-3,3,3-trifluoropropanoate (PubChem CID 22913170) has the molecular formula C28H30F3NO4 and a molecular weight of 501.55 g/mol. Its IUPAC name is [4-[6-(4-butoxyphenyl)-3-pyridinyl]phenyl] 2-butoxy-3,3,3-trifluoropropanoate.
| Compound Name | [4-[6-(4-butoxyphenyl)-3-pyridinyl]phenyl] 2-butoxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 22913170 |
| Molecular Formula | C28H30F3NO4 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | [4-[6-(4-butoxyphenyl)-3-pyridinyl]phenyl] 2-butoxy-3,3,3-trifluoropropanoate |
| SMILES | CCCCOc1ccc(-c2ccc(-c3ccc(OC(=O)C(OCCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C28H30F3NO4/c1-3-5-17-34-23-12-9-21(10-13-23)25-16-11-22(19-32-25)20-7-14-24(15-8-20)36-27(33)26(28(29,30)31)35-18-6-4-2/h7-16,19,26H,3-6,17-18H2,1-2H3 |
| InChIKey | ADTHJARXWMMDQN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|