C30H33F4NO3 — CID 67846530
[3-fluoro-4-[6-(4-pentylphenyl)-3-pyridinyl]phenyl] 3,3,3-trifluoro-2-pentoxypropanoate (PubChem CID 67846530) has the molecular formula C30H33F4NO3 and a molecular weight of 531.59 g/mol. Its IUPAC name is [3-fluoro-4-[6-(4-pentylphenyl)-3-pyridinyl]phenyl] 3,3,3-trifluoro-2-pentoxypropanoate.
| Compound Name | [3-fluoro-4-[6-(4-pentylphenyl)-3-pyridinyl]phenyl] 3,3,3-trifluoro-2-pentoxypropanoate |
|---|---|
| PubChem CID | 67846530 |
| Molecular Formula | C30H33F4NO3 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | [3-fluoro-4-[6-(4-pentylphenyl)-3-pyridinyl]phenyl] 3,3,3-trifluoro-2-pentoxypropanoate |
| SMILES | CCCCCOC(C(=O)Oc1ccc(-c2ccc(-c3ccc(CCCCC)cc3)nc2)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C30H33F4NO3/c1-3-5-7-9-21-10-12-22(13-11-21)27-17-14-23(20-35-27)25-16-15-24(19-26(25)31)38-29(36)28(30(32,33)34)37-18-8-6-4-2/h10-17,19-20,28H,3-9,18H2,1-2H3 |
| InChIKey | XYESWJFQXOHRDD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|