C26H25F11O4 — CID 57130559
[4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)phenyl] 4-[(4S)-4-methylhexoxy]benzoate (PubChem CID 57130559) has the molecular formula C26H25F11O4 and a molecular weight of 610.46 g/mol. Its IUPAC name is [4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)phenyl] 4-[(4S)-4-methylhexoxy]benzoate.
| Compound Name | [4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)phenyl] 4-[(4S)-4-methylhexoxy]benzoate |
|---|---|
| PubChem CID | 57130559 |
| Molecular Formula | C26H25F11O4 |
| Molecular Weight | 610.46 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | [4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)phenyl] 4-[(4S)-4-methylhexoxy]benzoate |
| SMILES | CC[C@H](C)CCCOc1ccc(C(=O)Oc2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H25F11O4/c1-3-16(2)5-4-14-39-18-8-6-17(7-9-18)21(38)41-20-12-10-19(11-13-20)40-15-22(27,28)23(29,30)24(31,32)25(33,34)26(35,36)37/h6-13,16H,3-5,14-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | HDCDMNRGFZSTGT-INIZCTEOSA-N |
| XLogP | 8.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.46 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|