C23H28O4 — CID 159031599
[2-[[7-(5-methyl-2-bicyclo[2.2.1]heptanyl)-7-tetracyclo[4.3.1.01,8.02,4]dec-2-enyl]oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 159031599) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is [2-[[7-(5-methyl-2-bicyclo[2.2.1]heptanyl)-7-tetracyclo[4.3.1.01,8.02,4]dec-2-enyl]oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[[7-(5-methyl-2-bicyclo[2.2.1]heptanyl)-7-tetracyclo[4.3.1.01,8.02,4]dec-2-enyl]oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 159031599 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [2-[[7-(5-methyl-2-bicyclo[2.2.1]heptanyl)-7-tetracyclo[4.3.1.01,8.02,4]dec-2-enyl]oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC1(C2CC3CC2CC3C)C2CC3C=C3C3(C2)CC31 |
| InChI | InChI=1S/C23H28O4/c1-3-20(24)26-11-21(25)27-23(18-7-13-5-14(18)4-12(13)2)16-6-15-8-17(15)22(9-16)10-19(22)23/h3,8,12-16,18-19H,1,4-7,9-11H2,2H3 |
| InChIKey | JUYNMKPFSKCFKI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|