C19H19F5N4O3 — CID 159042117
N-[1-[2-methyl-6-(2-oxopropyl)-4-pyridinyl]ethyl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine-3-carboxamide (PubChem CID 159042117) has the molecular formula C19H19F5N4O3 and a molecular weight of 446.38 g/mol. Its IUPAC name is N-[1-[2-methyl-6-(2-oxopropyl)-4-pyridinyl]ethyl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine-3-carboxamide.
| Compound Name | N-[1-[2-methyl-6-(2-oxopropyl)-4-pyridinyl]ethyl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 159042117 |
| Molecular Formula | C19H19F5N4O3 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[1-[2-methyl-6-(2-oxopropyl)-4-pyridinyl]ethyl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine-3-carboxamide |
| SMILES | CC(=O)Cc1cc(C(C)NC(=O)c2ccc(OCC(F)(F)C(F)(F)F)nn2)cc(C)n1 |
| InChI | InChI=1S/C19H19F5N4O3/c1-10-6-13(8-14(25-10)7-11(2)29)12(3)26-17(30)15-4-5-16(28-27-15)31-9-18(20,21)19(22,23)24/h4-6,8,12H,7,9H2,1-3H3,(H,26,30) |
| InChIKey | JWEQHFPDIXPDHN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|