C12H16N2 — CID 159057761
methane;2,4,8-trimethylquinazoline (PubChem CID 159057761) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is methane;2,4,8-trimethylquinazoline.
| Compound Name | methane;2,4,8-trimethylquinazoline |
|---|---|
| PubChem CID | 159057761 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | methane;2,4,8-trimethylquinazoline |
| SMILES | C.Cc1nc(C)c2cccc(C)c2n1 |
| InChI | InChI=1S/C11H12N2.CH4/c1-7-5-4-6-10-8(2)12-9(3)13-11(7)10;/h4-6H,1-3H3;1H4 |
| InChIKey | JYBPPPJEAZJTEW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |