C16H12NO2- — CID 7095758
4,5-dimethylacridine-9-carboxylate (PubChem CID 7095758) has the molecular formula C16H12NO2- and a molecular weight of 250.28 g/mol. Its IUPAC name is 4,5-dimethylacridine-9-carboxylate.
| Compound Name | 4,5-dimethylacridine-9-carboxylate |
|---|---|
| PubChem CID | 7095758 |
| Molecular Formula | C16H12NO2- |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4,5-dimethylacridine-9-carboxylate |
| SMILES | Cc1cccc2c(C(=O)[O-])c3cccc(C)c3nc12 |
| InChI | InChI=1S/C16H13NO2/c1-9-5-3-7-11-13(16(18)19)12-8-4-6-10(2)15(12)17-14(9)11/h3-8H,1-2H3,(H,18,19)/p-1 |
| InChIKey | LDRZBMBJYZPRFT-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|