C30H40F2N6 — CID 159061615
2-(aminomethyl)aniline;4-(aminomethyl)aniline;2-(2-fluorophenyl)ethanamine;2-(3-fluorophenyl)ethanamine (PubChem CID 159061615) has the molecular formula C30H40F2N6 and a molecular weight of 522.69 g/mol. Its IUPAC name is 2-(aminomethyl)aniline;4-(aminomethyl)aniline;2-(2-fluorophenyl)ethanamine;2-(3-fluorophenyl)ethanamine.
| Compound Name | 2-(aminomethyl)aniline;4-(aminomethyl)aniline;2-(2-fluorophenyl)ethanamine;2-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 159061615 |
| Molecular Formula | C30H40F2N6 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 2-(aminomethyl)aniline;4-(aminomethyl)aniline;2-(2-fluorophenyl)ethanamine;2-(3-fluorophenyl)ethanamine |
| SMILES | NCCc1cccc(F)c1.NCCc1ccccc1F.NCc1ccc(N)cc1.NCc1ccccc1N |
| InChI | InChI=1S/2C8H10FN.2C7H10N2/c9-8-3-1-2-7(6-8)4-5-10;9-8-4-2-1-3-7(8)5-6-10;8-5-6-1-3-7(9)4-2-6;8-5-6-3-1-2-4-7(6)9/h1-3,6H,4-5,10H2;1-4H,5-6,10H2;2*1-4H,5,8-9H2 |
| InChIKey | JYNSLZSOJRNCMX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|