C29H35FN4OS — CID 67582379
2-(aminomethyl)aniline;[2-[2-(aminomethyl)phenyl]sulfanylphenyl]methanol;2-(3-fluorophenyl)ethanamine (PubChem CID 67582379) has the molecular formula C29H35FN4OS and a molecular weight of 506.69 g/mol. Its IUPAC name is 2-(aminomethyl)aniline;[2-[2-(aminomethyl)phenyl]sulfanylphenyl]methanol;2-(3-fluorophenyl)ethanamine.
| Compound Name | 2-(aminomethyl)aniline;[2-[2-(aminomethyl)phenyl]sulfanylphenyl]methanol;2-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 67582379 |
| Molecular Formula | C29H35FN4OS |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 2-(aminomethyl)aniline;[2-[2-(aminomethyl)phenyl]sulfanylphenyl]methanol;2-(3-fluorophenyl)ethanamine |
| SMILES | NCCc1cccc(F)c1.NCc1ccccc1N.NCc1ccccc1Sc1ccccc1CO |
| InChI | InChI=1S/C14H15NOS.C8H10FN.C7H10N2/c15-9-11-5-1-3-7-13(11)17-14-8-4-2-6-12(14)10-16;9-8-3-1-2-7(6-8)4-5-10;8-5-6-3-1-2-4-7(6)9/h1-8,16H,9-10,15H2;1-3,6H,4-5,10H2;1-4H,5,8-9H2 |
| InChIKey | WQJQTSANPGSVKG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|