boric acid;phosphoric acid;silicic acid

H10BO11PSi — CID 159063190

IUPACboric acid;phosphoric acid;silicic acid
SMILESO=P(O)(O)O.OB(O)O.O[Si](O)(O)O
InChIInChI=1S/BH3O3.H3O4P.H4O4Si/c2-1(3)4;2*1-5(2,3)4/h2-4H;(H3,1,2,3,4);1-4H
InChIKeyJYSOTTHMQQDBFC-UHFFFAOYSA-N
MW255.94 g/mol
LogP-5.59
Rot. Bonds

About boric acid;phosphoric acid;silicic acid

boric acid;phosphoric acid;silicic acid (PubChem CID 159063190) has the molecular formula H10BO11PSi and a molecular weight of 255.94 g/mol. Its IUPAC name is boric acid;phosphoric acid;silicic acid.

Molecular Properties

Compound Nameboric acid;phosphoric acid;silicic acid
PubChem CID159063190
Molecular FormulaH10BO11PSi
Molecular Weight255.94 g/mol
Exact Mass255.98
IUPAC Nameboric acid;phosphoric acid;silicic acid
SMILESO=P(O)(O)O.OB(O)O.O[Si](O)(O)O
InChIInChI=1S/BH3O3.H3O4P.H4O4Si/c2-1(3)4;2*1-5(2,3)4/h2-4H;(H3,1,2,3,4);1-4H
InChIKeyJYSOTTHMQQDBFC-UHFFFAOYSA-N
XLogP-5.59
TPSA219.37 Ų
H-Bond Donors10
H-Bond Acceptors8
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500255.94
LogP ≤ 5-5.59
H-Bond Donors ≤ 510
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze boric acid;phosphoric acid;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of boric acid;phosphoric acid;silicic acid?
The IUPAC name of boric acid;phosphoric acid;silicic acid (CID 159063190) is boric acid;phosphoric acid;silicic acid.
What is the SMILES notation for boric acid;phosphoric acid;silicic acid?
The canonical SMILES for boric acid;phosphoric acid;silicic acid is O=P(O)(O)O.OB(O)O.O[Si](O)(O)O.
What is the InChIKey of boric acid;phosphoric acid;silicic acid?
The InChIKey is JYSOTTHMQQDBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O3.H3O4P.H4O4Si/c2-1(3)4;2*1-5(2,3)4/h2-4H;(H3,1,2,3,4);1-4H.
What are the key properties of boric acid;phosphoric acid;silicic acid?
boric acid;phosphoric acid;silicic acid has a molecular weight of 255.94 g/mol, XLogP of -5.59, 0 rotatable bonds, 10 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;phosphoric acid;silicic acid is sourced from PubChem (CID 159063190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).