About boric acid;phosphoric acid;silicic acid
boric acid;phosphoric acid;silicic acid (PubChem CID 159063190) has the molecular formula H10BO11PSi
and a molecular weight of 255.94 g/mol. Its IUPAC name is boric acid;phosphoric acid;silicic acid.
Molecular Properties
| Compound Name | boric acid;phosphoric acid;silicic acid |
| PubChem CID | 159063190 |
| Molecular Formula | H10BO11PSi |
| Molecular Weight | 255.94 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | boric acid;phosphoric acid;silicic acid |
| SMILES | O=P(O)(O)O.OB(O)O.O[Si](O)(O)O |
| InChI | InChI=1S/BH3O3.H3O4P.H4O4Si/c2-1(3)4;2*1-5(2,3)4/h2-4H;(H3,1,2,3,4);1-4H |
| InChIKey | JYSOTTHMQQDBFC-UHFFFAOYSA-N |
| XLogP | -5.59 |
| TPSA | 219.37 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.94 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze boric acid;phosphoric acid;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;phosphoric acid;silicic acid?
The IUPAC name of boric acid;phosphoric acid;silicic acid (CID 159063190) is boric acid;phosphoric acid;silicic acid.
What is the SMILES notation for boric acid;phosphoric acid;silicic acid?
The canonical SMILES for boric acid;phosphoric acid;silicic acid is O=P(O)(O)O.OB(O)O.O[Si](O)(O)O.
What is the InChIKey of boric acid;phosphoric acid;silicic acid?
The InChIKey is JYSOTTHMQQDBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O3.H3O4P.H4O4Si/c2-1(3)4;2*1-5(2,3)4/h2-4H;(H3,1,2,3,4);1-4H.
What are the key properties of boric acid;phosphoric acid;silicic acid?
boric acid;phosphoric acid;silicic acid has a molecular weight of 255.94 g/mol, XLogP of -5.59, 0 rotatable bonds, 10 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;phosphoric acid;silicic acid is sourced from PubChem (CID 159063190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).