About phosphoric acid;silicic acid;zirconium
phosphoric acid;silicic acid;zirconium (PubChem CID 173023136) has the molecular formula H7O8PSiZr
and a molecular weight of 285.33 g/mol. Its IUPAC name is phosphoric acid;silicic acid;zirconium.
Molecular Properties
| Compound Name | phosphoric acid;silicic acid;zirconium |
| PubChem CID | 173023136 |
| Molecular Formula | H7O8PSiZr |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 283.87 |
| IUPAC Name | phosphoric acid;silicic acid;zirconium |
| SMILES | O=P(O)(O)O.O[Si](O)(O)O.[Zr] |
| InChI | InChI=1S/H3O4P.H4O4Si.Zr/c2*1-5(2,3)4;/h(H3,1,2,3,4);1-4H; |
| InChIKey | VIZFGGJMKGYGER-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoric acid;silicic acid;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoric acid;silicic acid;zirconium?
The IUPAC name of phosphoric acid;silicic acid;zirconium (CID 173023136) is phosphoric acid;silicic acid;zirconium.
What is the SMILES notation for phosphoric acid;silicic acid;zirconium?
The canonical SMILES for phosphoric acid;silicic acid;zirconium is O=P(O)(O)O.O[Si](O)(O)O.[Zr].
What is the InChIKey of phosphoric acid;silicic acid;zirconium?
The InChIKey is VIZFGGJMKGYGER-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O4P.H4O4Si.Zr/c2*1-5(2,3)4;/h(H3,1,2,3,4);1-4H;.
What are the key properties of phosphoric acid;silicic acid;zirconium?
phosphoric acid;silicic acid;zirconium has a molecular weight of 285.33 g/mol, XLogP of -3.54, 0 rotatable bonds, 7 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoric acid;silicic acid;zirconium is sourced from PubChem (CID 173023136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).