C14H27N3O2 — CID 159070623
4-N,3-dibutylpyrrolidine-3,4-dicarboxamide (PubChem CID 159070623) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-N,3-dibutylpyrrolidine-3,4-dicarboxamide.
| Compound Name | 4-N,3-dibutylpyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 159070623 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 4-N,3-dibutylpyrrolidine-3,4-dicarboxamide |
| SMILES | CCCCNC(=O)C1CNCC1(CCCC)C(N)=O |
| InChI | InChI=1S/C14H27N3O2/c1-3-5-7-14(13(15)19)10-16-9-11(14)12(18)17-8-6-4-2/h11,16H,3-10H2,1-2H3,(H2,15,19)(H,17,18) |
| InChIKey | JZPIEHHLGQZCNF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|