C11H23N3O — CID 63911594
N-butyl-2,6-dimethylpiperazine-1-carboxamide (PubChem CID 63911594) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is N-butyl-2,6-dimethylpiperazine-1-carboxamide.
| Compound Name | N-butyl-2,6-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 63911594 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N-butyl-2,6-dimethylpiperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1C(C)CNCC1C |
| InChI | InChI=1S/C11H23N3O/c1-4-5-6-13-11(15)14-9(2)7-12-8-10(14)3/h9-10,12H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | SNQKMMQALUQNMT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|