C10H16IN — CID 15907576
(2R,4S,5R)-5-ethenyl-2-(iodomethyl)-1-azabicyclo[2.2.2]octane (PubChem CID 15907576) has the molecular formula C10H16IN and a molecular weight of 277.15 g/mol. Its IUPAC name is (2R,4S,5R)-5-ethenyl-2-(iodomethyl)-1-azabicyclo[2.2.2]octane.
| Compound Name | (2R,4S,5R)-5-ethenyl-2-(iodomethyl)-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 15907576 |
| Molecular Formula | C10H16IN |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (2R,4S,5R)-5-ethenyl-2-(iodomethyl)-1-azabicyclo[2.2.2]octane |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CI |
| InChI | InChI=1S/C10H16IN/c1-2-8-7-12-4-3-9(8)5-10(12)6-11/h2,8-10H,1,3-7H2/t8-,9-,10+/m0/s1 |
| InChIKey | HGRLDLDJCNTNPZ-LPEHRKFASA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|