C17H23FN2 — CID 11943530
1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[(4-fluorophenyl)methyl]methanamine (PubChem CID 11943530) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[(4-fluorophenyl)methyl]methanamine.
| Compound Name | 1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[(4-fluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 11943530 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[(4-fluorophenyl)methyl]methanamine |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CNCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN2/c1-2-14-12-20-8-7-15(14)9-17(20)11-19-10-13-3-5-16(18)6-4-13/h2-6,14-15,17,19H,1,7-12H2/t14-,15-,17+/m0/s1 |
| InChIKey | PKBVJSCXAJHNSY-YQQAZPJKSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|