C18H23N3 — CID 11943392
3-[[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]benzonitrile (PubChem CID 11943392) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]benzonitrile.
| Compound Name | 3-[[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 11943392 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3-[[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]benzonitrile |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CNCc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H23N3/c1-2-16-13-21-7-6-17(16)9-18(21)12-20-11-15-5-3-4-14(8-15)10-19/h2-5,8,16-18,20H,1,6-7,9,11-13H2/t16-,17-,18+/m0/s1 |
| InChIKey | OXAZPCWIDVZOGU-OKZBNKHCSA-N |
| XLogP | 2.54 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|