C17H22N2 — CID 162797023
N-benzyl-1-[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine (PubChem CID 162797023) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-benzyl-1-[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine.
| Compound Name | N-benzyl-1-[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
|---|---|
| PubChem CID | 162797023 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-benzyl-1-[(2R,4S,5R)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
| SMILES | C#C[C@@H]1CN2CC[C@H]1C[C@@H]2CNCc1ccccc1 |
| InChI | InChI=1S/C17H22N2/c1-2-15-13-19-9-8-16(15)10-17(19)12-18-11-14-6-4-3-5-7-14/h1,3-7,15-18H,8-13H2/t15-,16+,17-/m1/s1 |
| InChIKey | UPXXGLNVNQUQQR-IXDOHACOSA-N |
| XLogP | 2.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|