C18H22BrN3S — CID 162816697
1-(2-bromo-4-methylphenyl)-3-[[(2R,4R,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 162816697) has the molecular formula C18H22BrN3S and a molecular weight of 392.37 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-[[(2R,4R,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-[[(2R,4R,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 162816697 |
| Molecular Formula | C18H22BrN3S |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-[[(2R,4R,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | C#C[C@H]1CN2CC[C@@H]1C[C@@H]2CNC(=S)Nc1ccc(C)cc1Br |
| InChI | InChI=1S/C18H22BrN3S/c1-3-13-11-22-7-6-14(13)9-15(22)10-20-18(23)21-17-5-4-12(2)8-16(17)19/h1,4-5,8,13-15H,6-7,9-11H2,2H3,(H2,20,21,23)/t13-,14+,15+/m0/s1 |
| InChIKey | IGCXCTNBCOLBCF-RRFJBIMHSA-N |
| XLogP | 3.39 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|