C17H25N3S — CID 74714285
1-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-3-phenylthiourea (PubChem CID 74714285) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 1-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-3-phenylthiourea.
| Compound Name | 1-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 74714285 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)methyl]-3-phenylthiourea |
| SMILES | CCC1CN2CCC1CC2CNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C17H25N3S/c1-2-13-12-20-9-8-14(13)10-16(20)11-18-17(21)19-15-6-4-3-5-7-15/h3-7,13-14,16H,2,8-12H2,1H3,(H2,18,19,21) |
| InChIKey | HNPTWWHYGQEUJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|