C28H38N4S — CID 162854631
1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea (PubChem CID 162854631) has the molecular formula C28H38N4S and a molecular weight of 462.71 g/mol. Its IUPAC name is 1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea.
| Compound Name | 1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 162854631 |
| Molecular Formula | C28H38N4S |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea |
| SMILES | S=C(NC[C@H]1C[C@@H]2CCN1C[C@H]2CN1CCC(Cc2ccccc2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C28H38N4S/c33-28(30-26-9-5-2-6-10-26)29-19-27-18-24-13-16-32(27)21-25(24)20-31-14-11-23(12-15-31)17-22-7-3-1-4-8-22/h1-10,23-25,27H,11-21H2,(H2,29,30,33)/t24-,25+,27+/m0/s1 |
| InChIKey | KYOIMLLHKBBHOM-ZWEKWIFMSA-N |
| XLogP | 4.64 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|