C27H38N4OS — CID 162796163
1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 162796163) has the molecular formula C27H38N4OS and a molecular weight of 466.70 g/mol. Its IUPAC name is 1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 162796163 |
| Molecular Formula | C27H38N4OS |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1-[[(2R,4S,5R)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | S=C(NCc1ccco1)NC[C@H]1C[C@@H]2CCN1C[C@H]2CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H38N4OS/c33-27(29-18-26-7-4-14-32-26)28-17-25-16-23-10-13-31(25)20-24(23)19-30-11-8-22(9-12-30)15-21-5-2-1-3-6-21/h1-7,14,22-25H,8-13,15-20H2,(H2,28,29,33)/t23-,24+,25+/m0/s1 |
| InChIKey | POVPVQWNPXZJOP-ISJGIBHGSA-N |
| XLogP | 3.91 |
| TPSA | 43.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|