C20H30N4S2 — CID 162796992
1-phenyl-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 162796992) has the molecular formula C20H30N4S2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 1-phenyl-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-phenyl-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 162796992 |
| Molecular Formula | C20H30N4S2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-phenyl-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1C[C@H]2CCN1C[C@@H]2CN1CCSCC1)Nc1ccccc1 |
| InChI | InChI=1S/C20H30N4S2/c25-20(22-18-4-2-1-3-5-18)21-13-19-12-16-6-7-24(19)15-17(16)14-23-8-10-26-11-9-23/h1-5,16-17,19H,6-15H2,(H2,21,22,25)/t16-,17+,19+/m1/s1 |
| InChIKey | XIRPLXKNZDTNSI-AOIWGVFYSA-N |
| XLogP | 2.73 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|