C24H34N6S — CID 163017246
1-[[(2S,4R,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea (PubChem CID 163017246) has the molecular formula C24H34N6S and a molecular weight of 438.65 g/mol. Its IUPAC name is 1-[[(2S,4R,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea.
| Compound Name | 1-[[(2S,4R,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea |
|---|---|
| PubChem CID | 163017246 |
| Molecular Formula | C24H34N6S |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-[[(2S,4R,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea |
| SMILES | S=C(NC[C@@H]1C[C@H]2CCN1C[C@@H]2CN1CCCCC1)Nc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C24H34N6S/c31-24(27-21-5-7-22(8-6-21)30-13-4-10-26-30)25-16-23-15-19-9-14-29(23)18-20(19)17-28-11-2-1-3-12-28/h4-8,10,13,19-20,23H,1-3,9,11-12,14-18H2,(H2,25,27,31)/t19-,20+,23+/m1/s1 |
| InChIKey | HREQQNHAYRZBRL-QTEQDKRBSA-N |
| XLogP | 3.36 |
| TPSA | 48.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|