C30H43N5S — CID 162945546
1-[[(2S,4R,5S)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-[4-(dimethylamino)phenyl]thiourea (PubChem CID 162945546) has the molecular formula C30H43N5S and a molecular weight of 505.78 g/mol. Its IUPAC name is 1-[[(2S,4R,5S)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-[4-(dimethylamino)phenyl]thiourea.
| Compound Name | 1-[[(2S,4R,5S)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-[4-(dimethylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 162945546 |
| Molecular Formula | C30H43N5S |
| Molecular Weight | 505.78 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 1-[[(2S,4R,5S)-5-[(4-benzylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-[4-(dimethylamino)phenyl]thiourea |
| SMILES | CN(C)c1ccc(NC(=S)NC[C@@H]2C[C@H]3CCN2C[C@@H]3CN2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H43N5S/c1-33(2)28-10-8-27(9-11-28)32-30(36)31-20-29-19-25-14-17-35(29)22-26(25)21-34-15-12-24(13-16-34)18-23-6-4-3-5-7-23/h3-11,24-26,29H,12-22H2,1-2H3,(H2,31,32,36)/t25-,26+,29+/m1/s1 |
| InChIKey | QTEGWTCMFDJZKJ-ALTZYDRJSA-N |
| XLogP | 4.70 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.78 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|