C26H34FN5S — CID 74736003
1-[[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea (PubChem CID 74736003) has the molecular formula C26H34FN5S and a molecular weight of 467.66 g/mol. Its IUPAC name is 1-[[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea.
| Compound Name | 1-[[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 74736003 |
| Molecular Formula | C26H34FN5S |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-[[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylthiourea |
| SMILES | Fc1ccc(N2CCN(CC3CN4CCC3CC4CNC(=S)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H34FN5S/c27-22-6-8-24(9-7-22)31-14-12-30(13-15-31)18-21-19-32-11-10-20(21)16-25(32)17-28-26(33)29-23-4-2-1-3-5-23/h1-9,20-21,25H,10-19H2,(H2,28,29,33) |
| InChIKey | CVIWDHBRDDTHKE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|